roquefortine C
naturalproductmech:mibig-999e615425 MINTED SEEDED
Structure
| Standard InChIKey | SPWSUFUPTSJWNG-JJUKSXGLSA-N |
|---|---|
| SMILES | [H][C@@]12NC3=C(C=CC=C3)[C@@]1(C[C@@H]1N2C(=O)\C(NC1=O)=C/C1=CN=CN1)C(C)(C)C=C |
| Stereochemistry | fully defined |
| Cross-references | pubchem:5935070, npatlas:NPA016637 |
Filing pathway
Unclassified — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is nrps, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Penicillium rubens Wisconsin 54-1255 NCBITaxon:500485 |
BGC_CHARACTERIZED | mibig:BGC0000420 | DOI:10.1021/jacs.6b04915 |
Occurrences 15
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Penicillium piscarium NCBITaxon:104167 |
LOTUS | DOI:10.1007/BF02742579 |
| Penicillium farinosum NCBITaxon:211765 |
LOTUS | DOI:10.1007/BF01986141 |
| Huperzia serrata NCBITaxon:355589 |
LOTUS | DOI:10.1002/HLCA.200900331 |
| Penicillium crustosum NCBITaxon:36656 |
LOTUS | DOI:10.1039/C39830000560 |
| Hordeum vulgare NCBITaxon:4513 |
LOTUS | DOI:10.1128/AEM.56.9.2924-2926.1990 |
| Penicillium chrysogenum NCBITaxon:5076 |
LOTUS | DOI:10.1016/J.TET.2005.05.026 |
| Penicillium roqueforti NCBITaxon:5082 |
LOTUS | DOI:10.1016/S0040-4020(01)81556-8 |
| Penicillium roqueforti NCBITaxon:5082 |
LOTUS | DOI:10.1039/C39820000652 |
| Penicillium verrucosum NCBITaxon:60171 |
LOTUS | DOI:10.1021/NP50109A017 |
| Penicillium solitum NCBITaxon:60172 |
LOTUS | DOI:10.1007/BF01986141 |
| Penicillium solitum NCBITaxon:60172 |
LOTUS | DOI:10.1039/C39830000560 |
| Penicillium simplicissimum NCBITaxon:69488 |
LOTUS | DOI:10.1007/BF02742579 |
| Penicillium oxalicum NCBITaxon:69781 |
LOTUS | DOI:10.1039/C39830000560 |
| Gymnoascus reessii NCBITaxon:69890 |
LOTUS | DOI:10.1021/NP0503101 |
| Cordyceps farinosa NCBITaxon:89141 |
LOTUS | DOI:10.1007/BF01986141 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000420 | Penicillium rubens Wisconsin 54-1255 NCBITaxon:500485 |
CLUSTER_DEMONSTRATED | genbank:AM920436.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000420 | MIBIG | 5 |
This page is generated from data/natural_products/unclassified/roquefortine-c.yaml, which is generated from the committed inventories. Neither is edited by hand.