valinomycin
naturalproductmech:mibig-ebb9d93910 MINTED SEEDED enzyme inhibitor
Structure
| Standard InChIKey | FCFNRCROJUBPLU-ZJUJSLGGSA-N |
|---|---|
| SMILES | CC(C)[C@@H]1NC(=O)C(C)OC(=O)[C@H](NC(=O)[C@H](OC(=O)[C@@H](NC(=O)[C@H](C)OC(=O)[C@H](NC(=O)[C@H](OC(=O)[C@@H](NC(=O)[C@H](C)OC(=O)[C@H](NC(=O)[C@H](OC1=O)C(C)C)C(C)C)C(C)C)C(C)C)C(C)C)C(C)C)C(C)C)C(C)C |
| Stereochemistry | undefined stereocentres — the InChIKey does not distinguish this compound from its stereoisomers |
| Cross-references | npatlas:NPA06953, pubchem:3000706 |
Filing pathway
Unclassified — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is nrps, from MIBiG.
Producer organisms 2
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Streptomyces tsusimaensis NCBITaxon:285482 |
BGC_CHARACTERIZED | mibig:BGC0000453 | PMID:16511823 |
| Rothia nasimurium NCBITaxon:85336 |
SOURCE_ASSERTION | mibig:BGC0001341 | DOI:10.1128/aem.02671-10 |
Occurrences 25
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Streptomyces anulatus NCBITaxon:1892 |
LOTUS | DOI:10.1002/ASIA.200900011 |
| Streptomyces anulatus NCBITaxon:1892 |
LOTUS | DOI:10.1002/CBIC.200500425 |
| Streptomyces anulatus NCBITaxon:1892 |
LOTUS | DOI:10.1007/S10295-015-1679-5 |
| Streptomyces anulatus NCBITaxon:1892 |
LOTUS | DOI:10.1007/S11274-019-2704-Z |
| Streptomyces anulatus NCBITaxon:1892 |
LOTUS | DOI:10.1016/J.JBIOTEC.2017.05.008 |
| Streptomyces anulatus NCBITaxon:1892 |
LOTUS | DOI:10.1038/S41429-019-0183-Y |
| Streptomyces anulatus NCBITaxon:1892 |
LOTUS | DOI:10.1094/PHYTO-11-13-0327-R |
| Streptomyces anulatus NCBITaxon:1892 |
LOTUS | DOI:10.1128/AEM.64.12.4767-4773.1998 |
| Streptomyces anulatus NCBITaxon:1892 |
LOTUS | DOI:10.1128/IAI.68.1.165-169.2000 |
| Streptomyces anulatus NCBITaxon:1892 |
LOTUS | DOI:10.1128/JB.172.6.3108-3116.1990 |
| Streptomyces anulatus NCBITaxon:1892 |
LOTUS | DOI:10.1371/JOURNAL.PONE.0007194 |
| Streptomyces anulatus NCBITaxon:1892 |
LOTUS | DOI:10.3390/MD8020373 |
| Streptomyces exfoliatus NCBITaxon:1905 |
LOTUS | DOI:10.1002/ASIA.200900011 |
| Streptomyces exfoliatus NCBITaxon:1905 |
LOTUS | DOI:10.1002/CBIC.200500425 |
| Streptomyces exfoliatus NCBITaxon:1905 |
LOTUS | DOI:10.1007/S10295-015-1679-5 |
| Streptomyces exfoliatus NCBITaxon:1905 |
LOTUS | DOI:10.1007/S11274-019-2704-Z |
| Streptomyces exfoliatus NCBITaxon:1905 |
LOTUS | DOI:10.1016/J.JBIOTEC.2017.05.008 |
| Streptomyces exfoliatus NCBITaxon:1905 |
LOTUS | DOI:10.1038/S41429-019-0183-Y |
| Streptomyces exfoliatus NCBITaxon:1905 |
LOTUS | DOI:10.1094/PHYTO-11-13-0327-R |
| Streptomyces exfoliatus NCBITaxon:1905 |
LOTUS | DOI:10.1128/AEM.64.12.4767-4773.1998 |
| Streptomyces exfoliatus NCBITaxon:1905 |
LOTUS | DOI:10.1128/IAI.68.1.165-169.2000 |
| Streptomyces exfoliatus NCBITaxon:1905 |
LOTUS | DOI:10.1128/JB.172.6.3108-3116.1990 |
| Streptomyces exfoliatus NCBITaxon:1905 |
LOTUS | DOI:10.1371/JOURNAL.PONE.0007194 |
| Streptomyces exfoliatus NCBITaxon:1905 |
LOTUS | DOI:10.3390/MD8020373 |
| Streptomyces griseus NCBITaxon:1911 |
LOTUS | DOI:10.1002/ASIA.200900011 |
Biosynthetic gene clusters 2
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000453 | Streptomyces tsusimaensis NCBITaxon:285482 |
CLUSTER_DEMONSTRATED | genbank:DQ174261.1 |
| mibig:BGC0001341 | Rothia nasimurium NCBITaxon:85336 |
CLUSTER_UNSTATED | genbank:LXWF01000040.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Bioactivities 1
| Assay | Result | Reference |
|---|---|---|
| Luminescence cell-based high throughput primary assay to identify inhibitors of TEAD-YAP interaction. | ACTIVE | pubchem.aid:1259422 |
Open questions 1
shared-structure — This structure is reported by more than one MIBiG entry: BGC0000453, BGC0001341. Confirm they describe the same compound rather than an upstream cross-reference error.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000453 | MIBIG | 5 |
| BGC0001341 | MIBIG | 4 |
This page is generated from data/natural_products/unclassified/valinomycin-2.yaml, which is generated from the committed inventories. Neither is edited by hand.