A macrolide antibiotic that is tylonolide having a β-D-mycaminosyl residue attached at position 5.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
macrolide antibioticARO:0000000
CHEBI:17478CHEBI:25105CHEBI:51689CHEBI:63367ARO:0000000| Molecular formula | C31H51NO10 |
|---|---|
| Charge | 0 |
| Average mass | 597.746 Da |
| Monoisotopic mass | 597.3513 Da |
| Source | ChEBI |
| InChIKey | WGUJDBLMJBJUQU-VKRLOHBMSA-N |
CC[C@H]1OC(=O)C[C@@H](O)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)[C@@H](O)[C@H](N(C)C)[C@H]2O)[C@@H](CC=O)C[C@@H](C)C(=O)/C=C/C(C)=C/[C@@H]1CO
InChI=1S/C31H51NO10/c1-8-25-22(16-34)13-17(2)9-10-23(35)18(3)14-21(11-12-33)30(19(4)24(36)15-26(37)41-25)42-31-29(39)27(32(6)7)28(38)20(5)40-31/h9-10,12-13,18-22,24-25,27-31,34,36,38-39H,8,11,14-16H2,1-7H3/b10-9+,17-13+/t18-,19+,20-,21+,22-,24-,25-,27+,28-,29-,30-,31+/m1/s1
CHEBI:33281| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| ARO | ARO:3007570 |
mycaminosyltylonolide | antibioticmech:aro-5037da15f7 |
2026-08-30 |
| CHEBI | CHEBI:77011 |
5-O-mycaminosyltylonolide | antibioticmech:chebi-40f91388c6 |
2026-08-30 |
Seeded from data/raw/ inventories (ARO, CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories