A macrolide that is the 7-oxo derivative of zeaenol (the 5Z stereoisomer). Isolated from Fungi, it exhibits cytotoxic, antibacterial and inhibitory activity against NF-κB.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:2468CHEBI:25106CHEBI:33853CHEBI:35618CHEBI:35681| Molecular formula | C19H22O7 |
|---|---|
| Charge | 0 |
| Average mass | 362.378 Da |
| Monoisotopic mass | 362.13655 Da |
| Source | ChEBI |
| InChIKey | NEQZWEXWOFPKOT-BYRRXHGESA-N |
COc1cc(O)c2c(c1)/C=C/C[C@H](O)[C@H](O)C(=O)/C=C\C[C@H](C)OC2=O
InChI=1S/C19H22O7/c1-11-5-3-7-14(20)18(23)15(21)8-4-6-12-9-13(25-2)10-16(22)17(12)19(24)26-11/h3-4,6-7,9-11,15,18,21-23H,5,8H2,1-2H3/b6-4+,7-3-/t11-,15-,18+/m0/s1
CHEBI:33282| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:67559 |
5Z-7-oxozeaenol | antibioticmech:chebi-23bb4868f0 |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories