Albicidin phytotoxins produced by the sugarcane pathogen Xanthomonas albilineans is a potent DNA gyrase inhibitor with inhibitory effects significantly better than most DNA gyrase inhibitors. Albicidin acts primarily by inhibiting the religation of the cleaved DNA intermediate during the gyrase catalytic sequence similar to quinolones.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
nonribosomal peptide antibioticsARO:3009657
ARO:3009657| Molecular formula | C44H38N6O12 |
|---|---|
| Charge | 0 |
| Average mass | 842.8 Da |
| Monoisotopic mass | 842.25477067 Da |
| Source | PubChem · retrieved 2026-08-29 |
| InChIKey | NZSWNNDHPOTJNH-VEJILBAHSA-N |
C/C(=C\C1=CC=C(C=C1)O)/C(=O)NC2=CC=C(C=C2)C(=O)N[C@@H](CC#N)C(=O)NC3=CC=C(C=C3)C(=O)NC4=C(C(=C(C=C4)C(=O)NC5=C(C(=C(C=C5)C(=O)O)O)OC)O)OC
InChI=1S/C44H38N6O12/c1-23(22-24-4-14-29(51)15-5-24)39(54)46-27-10-6-26(7-11-27)41(56)50-34(20-21-45)43(58)47-28-12-8-25(9-13-28)40(55)48-32-18-16-30(35(52)37(32)61-2)42(57)49-33-19-17-31(44(59)60)36(53)38(33)62-3/h4-19,22,34,51-53H,20H2,1-3H3,(H,46,54)(H,47,58)(H,48,55)(H,49,57)(H,50,56)(H,59,60)/b23-22+/t34-/m0/s1
| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| ARO | ARO:3007658 |
albicidin | antibioticmech:aro-34c0642a61 |
2026-08-30 |
Seeded from data/raw/ inventories (ARO)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories