A pentacyclic triterpenoid that is olean-12-en-28-oic acid substituted by hydroxy groups at positions 2, 3 and 23 (the 2α,3β stereoisomer). Isolated from Symplocos lancifolia and Juglans sinensis, it exhibits antioxidant and antimicrobial activities.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:25872CHEBI:35868| Molecular formula | C30H48O5 |
|---|---|
| Charge | 0 |
| Average mass | 488.709 Da |
| Monoisotopic mass | 488.35017 Da |
| Source | ChEBI |
| InChIKey | RWNHLTKFBKYDOJ-DDHMHSPCSA-N |
[H][C@]12CC=C3[C@]4([H])CC(C)(C)CC[C@]4(C(=O)O)CC[C@@]3(C)[C@]1(C)CC[C@]1([H])[C@]2(C)C[C@@H](O)[C@H](O)[C@@]1(C)CO
InChI=1S/C30H48O5/c1-25(2)11-13-30(24(34)35)14-12-28(5)18(19(30)15-25)7-8-22-26(3)16-20(32)23(33)27(4,17-31)21(26)9-10-29(22,28)6/h7,19-23,31-33H,8-17H2,1-6H3,(H,34,35)/t19-,20+,21+,22+,23-,26-,27-,28+,29+,30-/m0/s1
CHEBI:33282CHEBI:35718| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:68381 |
arjunolic acid | antibioticmech:chebi-3a355e21e6 |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories