A dibenzooxepine that is dibenzo[b,e]oxepin-11(6H)-one substituted by hydroxy groups at positions 1, 6 and 10, a methyl group at position 8, a prenyl group at position 4 and a prenyloxy group at position 7. Isolated from Aspergillus, it exhibits antibacterial activity.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:26195CHEBI:38131CHEBI:38926CHEBI:3992| Molecular formula | C25H28O6 |
|---|---|
| Charge | 0 |
| Average mass | 424.493 Da |
| Monoisotopic mass | 424.18859 Da |
| Source | ChEBI |
| InChIKey | WKCOWVOAMWLTDQ-UHFFFAOYSA-N |
CC(C)=CCOc1c(C)cc(O)c2c1C(O)Oc1c(CC=C(C)C)ccc(O)c1C2=O
InChI=1S/C25H28O6/c1-13(2)6-7-16-8-9-17(26)20-22(28)19-18(27)12-15(5)23(30-11-10-14(3)4)21(19)25(29)31-24(16)20/h6,8-10,12,25-27,29H,7,11H2,1-5H3
CHEBI:33282| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:68859 |
arugosin B | antibioticmech:chebi-9d788d11dd |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories