A organic heterotetracyclic compound that is 10H-benzo[b]xanthene-7,10,12-trione substituted by hydroxy groups at positions 6 and 11, methoxy groups at positions 3 and 8 and a methyl group at position 1.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:26195CHEBI:35618CHEBI:37407CHEBI:38163CHEBI:3992| Molecular formula | C20H14O8 |
|---|---|
| Charge | 0 |
| Average mass | 382.324 Da |
| Monoisotopic mass | 382.06887 Da |
| Source | ChEBI |
| InChIKey | ZOQMSOSJEWBMHP-UHFFFAOYSA-N |
COC1=CC(=O)c2c(c(O)c3oc4cc(OC)cc(C)c4c(=O)c3c2O)C1=O
InChI=1S/C20H14O8/c1-7-4-8(26-2)5-10-12(7)17(23)15-18(24)13-9(21)6-11(27-3)16(22)14(13)19(25)20(15)28-10/h4-6,24-25H,1-3H3
CHEBI:33282CHEBI:35718| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:3096 |
bikaverin | antibioticmech:chebi-c480cda79e |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories