An enamide obtained by the formal condensation of the amino group of glycine with the carboxy group of 14,14-dibromotetradeca-2,13-dienoic acid (the 2E stereoisomer). It is isolated from the marine sponge Siliquariaspongia sp. and exhibits antibacterial properties.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:16180CHEBI:25384CHEBI:29348CHEBI:37141CHEBI:51751| Molecular formula | C16H25Br2NO3 |
|---|---|
| Charge | 0 |
| Average mass | 439.188 Da |
| Monoisotopic mass | 437.02012 Da |
| Source | ChEBI |
| InChIKey | ZLIHRGDEFDFVOK-ZRDIBKRKSA-N |
O=C(O)CNC(=O)/C=C/CCCCCCCCCC=C(Br)Br
InChI=1S/C16H25Br2NO3/c17-14(18)11-9-7-5-3-1-2-4-6-8-10-12-15(20)19-13-16(21)22/h10-12H,1-9,13H2,(H,19,20)(H,21,22)/b12-10+
CHEBI:33282| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:66405 |
motualevic acid A | antibioticmech:chebi-d56a188bf9 |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories