A 2H-azirine that is 2H-azirene-2-carboxylic acid substituted by a 13,13-dibromotrideca-1,12-dien-1-yl group at position 3 (the 2R stereoisomer). It is isolated from the marine sponge Siliquariaspongia sp. and exhibits antibacterial properties.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:25384CHEBI:37141| Molecular formula | C16H23Br2NO2 |
|---|---|
| Charge | 0 |
| Average mass | 421.173 Da |
| Monoisotopic mass | 419.00955 Da |
| Source | ChEBI |
| InChIKey | XWKHPPWOUIGVPT-SLZMIMFISA-N |
O=C(O)[C@@H]1N=C1/C=C/CCCCCCCCCC=C(Br)Br
InChI=1S/C16H23Br2NO2/c17-14(18)12-10-8-6-4-2-1-3-5-7-9-11-13-15(19-13)16(20)21/h9,11-12,15H,1-8,10H2,(H,20,21)/b11-9+/t15-/m1/s1
CHEBI:33282| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:66406 |
motualevic acid F | antibioticmech:chebi-5c0c7a6edf |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories