An aminoglycoside sulfate salt resulting from the reaction of ribostamycin with sulfuric acid.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:38012CHEBI:47779| Molecular formula | (H2O4S)n.C17H34N4O10 |
|---|---|
| Charge | 0 |
| Average mass | 552.556 Da |
| Monoisotopic mass | 552.19487 Da |
| Source | ChEBI |
| InChIKey | RTCDDYYZMGGHOE-YMSVYGIHSA-N |
NC[C@H]1O[C@H](O[C@H]2[C@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)[C@@H](O)[C@H](N)C[C@@H]2N)[C@H](N)[C@@H](O)[C@@H]1O.O=S(=O)(O)O
InChI=1S/C17H34N4O10.H2O4S/c18-2-6-10(24)12(26)8(21)16(28-6)30-14-5(20)1-4(19)9(23)15(14)31-17-13(27)11(25)7(3-22)29-17;1-5(2,3)4/h4-17,22-27H,1-3,18-21H2;(H2,1,2,3,4)/t4-,5+,6-,7-,8-,9+,10-,11-,12-,13-,14-,15-,16-,17+;/m1./s1
CHEBI:33281CHEBI:33282CHEBI:36047| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:10003 |
ribostamycin sulfate | antibioticmech:chebi-676201b2d4 |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories