A novel broad-spectrum anti-MRSA benzoquinolizine antibiotic effective against gram-positive and gram-negative pathogens.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
fluoroquinolone antibioticARO:0000001
CHEBI:31889ARO:0000001| Molecular formula | C19H21FN2O4 |
|---|---|
| Charge | 0 |
| Average mass | 360.385 Da |
| Monoisotopic mass | 360.14854 Da |
| Source | ChEBI |
| InChIKey | JYJTVFIEFKZWCJ-JTQLQIEISA-N |
C[C@H]1CCc2c(N3CCC(O)CC3)c(F)cc3c(=O)c(C(=O)O)cn1c23
InChI=1S/C19H21FN2O4/c1-10-2-3-12-16-13(18(24)14(19(25)26)9-22(10)16)8-15(20)17(12)21-6-4-11(23)5-7-21/h8-11,23H,2-7H2,1H3,(H,25,26)/t10-/m0/s1
CHEBI:33281CHEBI:36047| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| ARO | ARO:3005120 |
levonadifloxacin | antibioticmech:aro-6c3d2579b5 |
2026-08-30 |
| CHEBI | CHEBI:37908 |
(S)-nadifloxacin | antibioticmech:chebi-b0f94261f2 |
2026-08-30 |
Seeded from data/raw/ inventories (ARO, CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories