Tetracenomycin A2 is a tetracenomycin antibiotic, a methyl ester and a tertiary alpha-hydroxy ketone.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
tetracenomycin antibioticARO:3007034
CHEBI:25248CHEBI:48132CHEBI:51286ARO:3007034| Molecular formula | C23H18O8 |
|---|---|
| Charge | 0 |
| Average mass | 422.389 Da |
| Monoisotopic mass | 422.10017 Da |
| Source | ChEBI |
| InChIKey | BXLGPMDGOMEFBX-UHFFFAOYSA-N |
COC(=O)c1c(OC)cc2cc3c(c(O)c2c1C)C(=O)c1c(O)cc(OC)cc1C3=O
InChI=1S/C23H18O8/c1-9-16-10(6-15(30-3)17(9)23(28)31-4)5-12-19(21(16)26)22(27)18-13(20(12)25)7-11(29-2)8-14(18)24/h5-8,24,26H,1-4H3
CHEBI:33281| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| ARO | ARO:3007037 |
tetracenomycin A2 | antibioticmech:aro-4077d9d6ef |
2026-08-30 |
| CHEBI | CHEBI:32197 |
tetracenomycin A2 | antibioticmech:chebi-82ed08f86c |
2026-08-30 |
Seeded from data/raw/ inventories (ARO, CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories