A carbotricyclic compound and sesquiterpene that is 1a,2,3,4,4a,5,6,7b-octahydro-1H-cyclopropa[e]azulene which is substituted by methyl groups at positions 1, 1, 4 and 7 (the 1aR,4R,4aR,7bS- diastereoisomer). It has been isolated from several plant species such as Anaphalis nubigena and Jatropha ribifolia.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:35189CHEBI:38032| Molecular formula | C15H24 |
|---|---|
| Charge | 0 |
| Average mass | 204.357 Da |
| Monoisotopic mass | 204.1878 Da |
| Source | ChEBI |
| InChIKey | SPCXZDDGSGTVAW-XIDUGBJDSA-N |
[H][C@]12CCC(C)=C1[C@]1([H])C(C)(C)[C@]1([H])CC[C@H]2C
InChI=1S/C15H24/c1-9-6-8-12-14(15(12,3)4)13-10(2)5-7-11(9)13/h9,11-12,14H,5-8H2,1-4H3/t9-,11-,12-,14-/m1/s1
CHEBI:33282| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:61699 |
(−)-α-gurjunene | antibioticmech:chebi-670bdceaad |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories