A carboxylic ester resulting from the formal condensation of the carboxy group of indole-3-acetic acid with the hydroxy group of 2-phenylethanol.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:24828CHEBI:33308| Molecular formula | C18H17NO2 |
|---|---|
| Charge | 0 |
| Average mass | 279.339 Da |
| Monoisotopic mass | 279.12593 Da |
| Source | ChEBI |
| InChIKey | IRHVVAKMDAHHAI-UHFFFAOYSA-N |
O=C(Cc1cnc2ccccc12)OCCc1ccccc1
InChI=1S/C18H17NO2/c20-18(21-11-10-14-6-2-1-3-7-14)12-15-13-19-17-9-5-4-8-16(15)17/h1-9,13,19H,10-12H2
CHEBI:35718| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:141317 |
2-phenylethyl 1H-indol-3-ylacetate | antibioticmech:chebi-6498abe999 |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories