5-Fluorouracil (5FU) is an antimetabolite typically used as a cancer treatment and is cytotoxic. It is a pyrimidine analogue inhibits thymidylate synthase which halts the DNA synthesis. Its cytotoxic effects on eukaryotic cells have also allowed the drug to be explored for fungal infection treatment as well.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
pyrimidine antifungalARO:3007560
ARO:3007560| Molecular formula | C4H3FN2O2 |
|---|---|
| Charge | 0 |
| Average mass | 130.078 Da |
| Monoisotopic mass | 130.01786 Da |
| Source | ChEBI |
| InChIKey | GHASVSINZRGABV-UHFFFAOYSA-N |
O=c1ncc(F)c(=O)n1
InChI=1S/C4H3FN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9)
| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| ARO | ARO:3009138 |
5-Fluorouracil | antibioticmech:aro-48b83a8ef7 |
2026-08-30 |
Seeded from data/raw/ inventories (ARO)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories