A macrolide that is isolated from several Streptomyces species and displays antibiotic, antineoplastic and antimalarial properties.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:23824CHEBI:25106CHEBI:25384CHEBI:35681CHEBI:80291| Molecular formula | C28H43NO6 |
|---|---|
| Charge | 0 |
| Average mass | 489.653 Da |
| Monoisotopic mass | 489.30904 Da |
| Source | ChEBI |
| InChIKey | OJCKRNPLOZHAOU-JTHVHBRGSA-N |
[H][C@]1([C@]2([H])CCC[C@H]2C(=O)O)C/C=C/C=C(/C#N)[C@H](O)[C@@H](C)C[C@H](C)C[C@H](C)C[C@H](C)[C@@H](O)CC(=O)O1
InChI=1S/C28H43NO6/c1-17-12-18(2)14-20(4)27(32)21(16-29)8-5-6-11-25(22-9-7-10-23(22)28(33)34)35-26(31)15-24(30)19(3)13-17/h5-6,8,17-20,22-25,27,30,32H,7,9-15H2,1-4H3,(H,33,34)/b6-5+,21-8-/t17-,18+,19-,20-,22+,23+,24-,25+,27+/m0/s1
CHEBI:33281CHEBI:35718CHEBI:38068| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:78661 |
borrelidin | antibioticmech:chebi-c37145ea23 |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories