A mixture comprising approximately equal amounts of (E)- and (Z)-fluomorph. It is used as an agrochemical fungicide for the control oomcyetes such as downey mildew on vegetables and grapes.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:60004CHEBI:87134| Molecular formula | C21H22FNO4 |
|---|---|
| Charge | 0 |
| Average mass | 371.408 Da |
| Monoisotopic mass | 371.15329 Da |
| Source | ChEBI |
| InChIKey | BKBSMMUEEAWFRX-UHFFFAOYSA-N |
[H]C(C(=O)N1CCOCC1)=C(c1ccc(F)cc1)c1ccc(OC)c(OC)c1
InChI=1S/C21H22FNO4/c1-25-19-8-5-16(13-20(19)26-2)18(15-3-6-17(22)7-4-15)14-21(24)23-9-11-27-12-10-23/h3-8,13-14H,9-12H2,1-2H3
CHEBI:24127CHEBI:35718CHEBI:86328| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:83428 |
flumorph | antibioticmech:chebi-a1b8902166 |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories