A monocarboxylic acid amide obtained by formal condensation of the carboxy group of 3-isobutoxyphenoxyacetic acid with the amino group of 4-methoxyaniline.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:29347CHEBI:35618CHEBI:62733| Molecular formula | C19H23NO4 |
|---|---|
| Charge | 0 |
| Average mass | 329.396 Da |
| Monoisotopic mass | 329.16271 Da |
| Source | ChEBI |
| InChIKey | JNQHDEHVHXLCAL-UHFFFAOYSA-N |
COc1ccc(NC(=O)COc2cccc(OCC(C)C)c2)cc1
InChI=1S/C19H23NO4/c1-14(2)12-23-17-5-4-6-18(11-17)24-13-19(21)20-15-7-9-16(22-3)10-8-15/h4-11,14H,12-13H2,1-3H3,(H,20,21)
CHEBI:35718| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:82641 |
gepinacin | antibioticmech:chebi-f518b3b1c5 |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories