An indole alkaloid that is 1,3-dihydro-2H-indol-2-one substituted by a methoxy(phenyl)methylidene group at position 3 (the 3E stereoisomer). Isolated from Isatis costata, it exhibits antifungal activity.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:24829CHEBI:38958CHEBI:47985| Molecular formula | C16H13NO2 |
|---|---|
| Charge | 0 |
| Average mass | 251.285 Da |
| Monoisotopic mass | 251.09463 Da |
| Source | ChEBI |
| InChIKey | VRJYLVZCUCQVBL-CCEZHUSRSA-N |
CO/C(=C1/C(=O)Nc2ccccc21)c1ccccc1
InChI=1S/C16H13NO2/c1-19-15(11-7-3-2-4-8-11)14-12-9-5-6-10-13(12)17-16(14)18/h2-10H,1H3,(H,17,18)/b15-14+
CHEBI:35718| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:66087 |
isatinone A | antibioticmech:chebi-5f1d494236 |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories