A benzochromenone that is 6H-benzo[c]chromen-6-one which is substituted by a methyl group at position 1, chloro group at position 2, hydroxy groups at positions positions 3 and 7, and by a methoxy group at position 9.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:18946CHEBI:33822CHEBI:35618CHEBI:36683CHEBI:64986| Molecular formula | C15H11ClO5 |
|---|---|
| Charge | 0 |
| Average mass | 306.701 Da |
| Monoisotopic mass | 306.0295 Da |
| Source | ChEBI |
| InChIKey | WMOJBLDBGQOTOS-UHFFFAOYSA-N |
COc1cc(O)c2c(=O)oc3cc(O)c(Cl)c(C)c3c2c1
InChI=1S/C15H11ClO5/c1-6-12-8-3-7(20-2)4-9(17)13(8)15(19)21-11(12)5-10(18)14(6)16/h3-5,17-18H,1-2H3
CHEBI:33281CHEBI:35718| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:141334 |
palmariol B | antibioticmech:chebi-9481041fb0 |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories