An organic polycyclic compound that is 1,2,6b,7,8,12b-hexahydroperylene-3,9-dione which is substituted at positions 1, 4, 7, and 10 by hydroxy groups (the all-S isomer).
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:33853CHEBI:35681CHEBI:51958CHEBI:76224| Molecular formula | C20H16O6 |
|---|---|
| Charge | 0 |
| Average mass | 352.342 Da |
| Monoisotopic mass | 352.09469 Da |
| Source | ChEBI |
| InChIKey | MCWOXLPZYFOWRX-YXAMBPQSSA-N |
[H][C@]12c3ccc(O)c4c3[C@]([H])(c3ccc(O)c(c31)C(=O)C[C@@H]2O)[C@@H](O)CC4=O
InChI=1S/C20H16O6/c21-9-3-1-7-15-11(23)5-14(26)20-10(22)4-2-8(18(15)20)16-12(24)6-13(25)19(9)17(7)16/h1-4,11-12,15-16,21-24H,5-6H2/t11-,12-,15+,16+/m0/s1
CHEBI:35718| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:141330 |
stemphyperylenol | antibioticmech:chebi-d5aaf60cd7 |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories