A carbazole alkaloid that is 9H-carbazole substituted by a methyl group at position 2, methoxy groups at positions 3 and 4 and a (2S)-2-hydroxypropyl group at position 1. Isolated from mycelial solid culture of Streptoverticillium morookaense, it exhibits antifungal activity.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:35618CHEBI:35681CHEBI:74510| Molecular formula | C18H21NO3 |
|---|---|
| Charge | 0 |
| Average mass | 299.37 Da |
| Monoisotopic mass | 299.15214 Da |
| Source | ChEBI |
| InChIKey | BSCARUQHRDHPML-SNVBAGLBSA-N |
COc1c(C)c(C[C@@H](C)O)c2nc3ccccc3c2c1OC
InChI=1S/C18H21NO3/c1-10(20)9-13-11(2)17(21-3)18(22-4)15-12-7-5-6-8-14(12)19-16(13)15/h5-8,10,19-20H,9H2,1-4H3/t10-/m1/s1
CHEBI:35718| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:66525 |
streptoverticillin | antibioticmech:chebi-26d4459160 |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories