A monocarboxylic acid amide resulting from the formal condensation of the carboxy group of 4-methyl-1,2,3-thiadiazole-5-carboxylic acid with the amino group of 3-chloro-4-methylaniline. It is a fungicide used particularly for the control of fungal diseases in rice.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:29347CHEBI:33261CHEBI:38099CHEBI:83403CHEBI:87015| Molecular formula | C11H10ClN3OS |
|---|---|
| Charge | 0 |
| Average mass | 267.741 Da |
| Monoisotopic mass | 267.02331 Da |
| Source | ChEBI |
| InChIKey | VJQYLJSMBWXGDV-UHFFFAOYSA-N |
Cc1ccc(NC(=O)c2snnc2C)cc1Cl
InChI=1S/C11H10ClN3OS/c1-6-3-4-8(5-9(6)12)13-11(16)10-7(2)14-15-17-10/h3-5H,1-2H3,(H,13,16)
CHEBI:24127CHEBI:35718CHEBI:86328| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:81825 |
tiadinil | antibioticmech:chebi-b2a86fc452 |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories