An indole alkaloid that is the 1,2-dehydro derivative of geissoschizoline. Isolated from Geissospermum sericeum, it exhibits antiplasmodial activity.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:15734CHEBI:38164CHEBI:38958| Molecular formula | C19H24N2O |
|---|---|
| Charge | 0 |
| Average mass | 296.414 Da |
| Monoisotopic mass | 296.18886 Da |
| Source | ChEBI |
| InChIKey | XJEKUKWZYMNSDW-XTXPVBGVSA-N |
[H][C@@]12C[C@]3([H])N(CC[C@]34C(=Nc3ccccc34)[C@H]1CO)C[C@H]2CC
InChI=1S/C19H24N2O/c1-2-12-10-21-8-7-19-15-5-3-4-6-16(15)20-18(19)14(11-22)13(12)9-17(19)21/h3-6,12-14,17,22H,2,7-11H2,1H3/t12-,13+,14+,17+,19-/m1/s1
CHEBI:64915| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:65736 |
1,2-dehydrogeissoschizoline | antibioticmech:chebi-fbb59d4d2a |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories