A sesquiterpenoid that is bisabola-2,10-diene substituted by a peroxy group between positions 2 and 10 (the 1S,4R,6R stereoisomer). Isolated from Artemisia stolonifera and Eupatorium rufescens, it exhibits antineoplastic and antiplasmodial activity.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:25702CHEBI:26658| Molecular formula | C15H24O2 |
|---|---|
| Charge | 0 |
| Average mass | 236.355 Da |
| Monoisotopic mass | 236.17763 Da |
| Source | ChEBI |
| InChIKey | LJPSCRDRIZSODI-ZGKBOVNRSA-N |
[H][C@]1([C@@H](C)CCC=C(C)C)C[C@H]2OO[C@@H]1C=C2C
InChI=1S/C15H24O2/c1-10(2)6-5-7-11(3)13-9-14-12(4)8-15(13)17-16-14/h6,8,11,13-15H,5,7,9H2,1-4H3/t11-,13+,14+,15+/m0/s1
CHEBI:64915| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:65844 |
1S,4R,6R-1,4-endoperoxy-bisabola-2,10-diene | antibioticmech:chebi-cc18deac9a |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories