A pentacyclic triterpenoid that is the cinnamate ester obtained by the formal condensation of the carboxylic group of cis-caffeic acid with the hydroxy group of lupeol (the 3β stereoisomer). It is isolated from the fruits of Bruguiera parviflora and exhibits antimalarial activity.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:25872CHEBI:33566CHEBI:36087| Molecular formula | C39H56O4 |
|---|---|
| Charge | 0 |
| Average mass | 588.873 Da |
| Monoisotopic mass | 588.41786 Da |
| Source | ChEBI |
| InChIKey | NIKLINODNHPPMX-JPXCXHODSA-N |
[H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@@]4(C)CC[C@@H](C(=C)C)[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](OC(=O)/C=C\c3ccc(O)c(O)c3)CC[C@]21C
InChI=1S/C39H56O4/c1-24(2)26-15-18-36(5)21-22-38(7)27(34(26)36)11-13-31-37(6)19-17-32(35(3,4)30(37)16-20-39(31,38)8)43-33(42)14-10-25-9-12-28(40)29(41)23-25/h9-10,12,14,23,26-27,30-32,34,40-41H,1,11,13,15-22H2,2-8H3/b14-10-/t26-,27+,30-,31+,32-,34+,36+,37-,38+,39+/m0/s1
CHEBI:38068| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:65549 |
3-(Z)-caffeoyllupeol | antibioticmech:chebi-d3e42a0d46 |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories