A heteropentacyclic compound that is the 9-methoxy derivative of alisiaquinone A. An antiplasmodial drug isolated from New Caledonian deep water sponge.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:25830CHEBI:38164CHEBI:59780| Molecular formula | C22H22O6 |
|---|---|
| Charge | 0 |
| Average mass | 382.412 Da |
| Monoisotopic mass | 382.14164 Da |
| Source | ChEBI |
| InChIKey | FYMHBDYBAOKOHD-YSFYHYPLSA-N |
[H][C@@]12[C@]3(C)CCC[C@]1(C)c1cc4c(cc1C(=O)[C@]2(O)OC3)C(=O)C(OC)=CC4=O
InChI=1S/C22H22O6/c1-20-5-4-6-21(2)14-8-11-12(17(24)16(27-3)9-15(11)23)7-13(14)18(25)22(26,19(20)21)28-10-20/h7-9,19,26H,4-6,10H2,1-3H3/t19-,20-,21-,22+/m1/s1
CHEBI:64915| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:65383 |
alisiaquinone B | antibioticmech:chebi-34d6bddb31 |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories