A bridged organic heteropentacyclic compound that is 3,4,5,6-tetrahydro-2H,8H-2,6-epoxyoxocino[3,2-b]xanthen-8-one substituted by a hydroxy group at position 7, a methoxy group at position 9 and a methyl group at position 2. It is isolated from the marine derived fungus Chaetomium and has antiprotozoal activity.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:33853CHEBI:35990CHEBI:38164CHEBI:3992CHEBI:59779| Molecular formula | C20H18O6 |
|---|---|
| Charge | 0 |
| Average mass | 354.358 Da |
| Monoisotopic mass | 354.11034 Da |
| Source | ChEBI |
| InChIKey | ZUEKQPJBVORAFH-UHFFFAOYSA-N |
COc1cccc2oc3cc4c(c(O)c3c(=O)c12)C1CCCC(C)(O4)O1
InChI=1S/C20H18O6/c1-20-8-4-7-12(25-20)16-14(26-20)9-13-17(19(16)22)18(21)15-10(23-2)5-3-6-11(15)24-13/h3,5-6,9,12,22H,4,7-8H2,1-2H3
CHEBI:35820| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:65612 |
chaetoxanthone B | antibioticmech:chebi-c35cb19fee |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories