A carboxamidinium ion resulting from the protonation of both of the amidino groups of diminazene. The major species at pH 7.3.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:77718| Molecular formula | C14H17N7 |
|---|---|
| Charge | 2 |
| Average mass | 283.339 Da |
| Monoisotopic mass | 283.15345 Da |
| Source | ChEBI |
| InChIKey | XNYZHCFCZNMTFY-UHFFFAOYSA-P |
NC(=[NH2+])c1ccc(N=NNc2ccc(C(N)=[NH2+])cc2)cc1
InChI=1S/C14H15N7/c15-13(16)9-1-5-11(6-2-9)19-21-20-12-7-3-10(4-8-12)14(17)18/h1-8H,(H3,15,16)(H3,17,18)(H,19,20)/p+2
CHEBI:36335| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:82614 |
diminazene(2+) | antibioticmech:chebi-0781d01102 |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories