A kaempferol O-glucoside that is the decaacetate ester derivative of paeonoside. Isolated from the aerial parts of Delphinium staphisagria, it exhibits trypanocidal activity.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:22798CHEBI:47622CHEBI:64634| Molecular formula | C47H50O26 |
|---|---|
| Charge | 0 |
| Average mass | 1030.891 Da |
| Monoisotopic mass | 1030.25903 Da |
| Source | ChEBI |
| InChIKey | NLVNWKWBXDAKIC-GHNQEIAISA-N |
CC(=O)OC[C@H]1O[C@@H](Oc2cc(OC(C)=O)c3c(=O)c(O[C@@H]4O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]4OC(C)=O)c(-c4ccc(OC(C)=O)cc4)oc3c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O
InChI=1S/C47H50O26/c1-19(48)59-17-34-39(63-23(5)52)42(65-25(7)54)44(67-27(9)56)46(71-34)69-31-15-32(62-22(4)51)36-33(16-31)70-38(29-11-13-30(14-12-29)61-21(3)50)41(37(36)58)73-47-45(68-28(10)57)43(66-26(8)55)40(64-24(6)53)35(72-47)18-60-20(2)49/h11-16,34-35,39-40,42-47H,17-18H2,1-10H3/t34-,35-,39-,40-,42+,43+,44-,45-,46-,47+/m1/s1
CHEBI:36335| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:67930 |
paeonoside decaacetate | antibioticmech:chebi-8497fadb31 |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories