A quercetin O-glucoside that is the decaacetate ester derivative of petiolaroside. Isolated from the aerial parts of Delphinium staphisagria, it exhibits trypanocidal activity.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:22798CHEBI:47622CHEBI:64621| Molecular formula | C47H50O25 |
|---|---|
| Charge | 0 |
| Average mass | 1014.892 Da |
| Monoisotopic mass | 1014.26412 Da |
| Source | ChEBI |
| InChIKey | WVTZEWYTKKLYOF-RFTFDKKMSA-N |
CC(=O)C[C@H]1O[C@@H](Oc2c(-c3ccc(OC(C)=O)c(OC(C)=O)c3)oc3cc(O[C@@H]4O[C@@H](C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]4OC(C)=O)cc(OC(C)=O)c3c2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O
InChI=1S/C47H50O25/c1-18(48)14-35-40(64-24(7)53)43(66-26(9)55)45(68-28(11)57)47(71-35)72-41-37(58)36-33(62-22(5)51)16-30(17-34(36)70-39(41)29-12-13-31(60-20(3)49)32(15-29)61-21(4)50)69-46-44(67-27(10)56)42(65-25(8)54)38(19(2)59-46)63-23(6)52/h12-13,15-17,19,35,38,40,42-47H,14H2,1-11H3/t19-,35+,38-,40+,42+,43-,44+,45+,46-,47-/m0/s1
CHEBI:36335| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:67933 |
petiolaroside decaacetate | antibioticmech:chebi-f41799c59d |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories