A quassinoid isolated from Quassia indica and Samadera madagascariensis. It exhibits antimalarial and cytotoxic activities.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:2468CHEBI:25000CHEBI:35681CHEBI:35990CHEBI:37407CHEBI:38164CHEBI:51689CHEBI:72485| Molecular formula | C19H22O7 |
|---|---|
| Charge | 0 |
| Average mass | 362.378 Da |
| Monoisotopic mass | 362.13655 Da |
| Source | ChEBI |
| InChIKey | CVLVYBSPYHCGGU-VQXUUFQGSA-N |
[H][C@@]12C(=O)O[C@@]3([H])[C@H](O)[C@@]4([H])[C@@]1(CO[C@@]23C)C(=O)C[C@@]1([H])C(C)=CC(=O)[C@@H](O)[C@]41C
InChI=1S/C19H22O7/c1-7-4-9(20)14(23)17(2)8(7)5-10(21)19-6-25-18(3)13(19)16(24)26-15(18)11(22)12(17)19/h4,8,11-15,22-23H,5-6H2,1-3H3/t8-,11+,12+,13-,14+,15-,17-,18-,19+/m0/s1
CHEBI:38068| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:66159 |
samaderine B | antibioticmech:chebi-91f3db5e7e |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories