A steroid sulfate that is 5α-ergostane substituted by sulfate groups at positions 2, 3 and 6 (the (2β,3α,6α stereoisomer).
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:16158| Molecular formula | C28H50O12S3 |
|---|---|
| Charge | 0 |
| Average mass | 674.897 Da |
| Monoisotopic mass | 674.24644 Da |
| Source | ChEBI |
| InChIKey | WBHAMVHLRVKJRH-VZAWWNCJSA-N |
[H][C@@]12C[C@H](OS(=O)(=O)O)[C@@]3([H])C[C@H](OS(=O)(=O)O)[C@@H](OS(=O)(=O)O)C[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CC[C@H](C)C(C)C
InChI=1S/C28H50O12S3/c1-16(2)17(3)7-8-18(4)20-9-10-21-19-13-24(38-41(29,30)31)23-14-25(39-42(32,33)34)26(40-43(35,36)37)15-28(23,6)22(19)11-12-27(20,21)5/h16-26H,7-15H2,1-6H3,(H,29,30,31)(H,32,33,34)(H,35,36,37)/t17-,18+,19-,20+,21-,22-,23+,24-,25-,26-,27+,28+/m0/s1
CHEBI:64947CHEBI:64949| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:72479 |
halistanol sulfonic acid G | antibioticmech:chebi-59b7bde878 |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories