A pentitol derivative that is 3-O-acetyl-1-deoxypentitol substituted by a 4-methoxyphenyl group at position 1. Isolated from the fermentation broth of Pseudomonas fluorescens and Pseudomonas putida, it exhibits anti-HSV-1 activity.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:25235CHEBI:27136CHEBI:47622CHEBI:63434| Molecular formula | C14H20O6 |
|---|---|
| Charge | 0 |
| Average mass | 284.308 Da |
| Monoisotopic mass | 284.12599 Da |
| Source | ChEBI |
| InChIKey | JATBUOZGJQJSGA-UHFFFAOYSA-N |
COc1ccc(CC(O)C(OC(C)=O)C(O)CO)cc1
InChI=1S/C14H20O6/c1-9(16)20-14(13(18)8-15)12(17)7-10-3-5-11(19-2)6-4-10/h3-6,12-15,17-18H,7-8H2,1-2H3
CHEBI:64953| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:66140 |
karalicin | antibioticmech:chebi-8588964c7a |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories