Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:23239| Molecular formula | C62H87N13O16 |
|---|---|
| Charge | 0 |
| Average mass | 1270.453 Da |
| Monoisotopic mass | 1269.63937 Da |
| Source | ChEBI |
| InChIKey | YXHLJMWYDTXDHS-IRFLANFNSA-N |
[H][C@@]12CCCN1C(=O)[C@@H](C(C)C)NC(=O)[C@@H](NC(=O)c1c3nc4c(C(=O)N[C@@H]5C(=O)N[C@H](C(C)C)C(=O)N6CCC[C@@]6([H])C(=O)N(C)CC(=O)N(C)[C@@H](C(C)C)C(=O)O[C@@H]5C)cc(N)c(C)c4oc-3c(C)c(=O)c1N)[C@@H](C)OC(=O)[C@H](C(C)C)N(C)C(=O)CN(C)C2=O
InChI=1S/C62H87N13O16/c1-26(2)42-59(85)74-21-17-19-36(74)57(83)70(13)24-38(76)72(15)48(28(5)6)61(87)89-32(11)44(55(81)66-42)68-53(79)34-23-35(63)30(9)51-46(34)65-47-40(41(64)50(78)31(10)52(47)91-51)54(80)69-45-33(12)90-62(88)49(29(7)8)73(16)39(77)25-71(14)58(84)37-20-18-22-75(37)60(86)43(27(3)4)67-56(45)82/h23,26-29,32-33,36-37,42-45,48-49H,17-22,24-25,63-64H2,1-16H3,(H,66,81)(H,67,82)(H,68,79)(H,69,80)/t32-,33-,36+,37+,42-,43-,44+,45+,48+,49+/m1/s1
CHEBI:33281| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:52304 |
7-aminoactinomycin D | antibioticmech:chebi-fa4ba8c81f |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories