A monocarboxylic acid amide with formula C28H42ClNO7, that is produced by Chondromyces crocatus and exhibits antibiotic properties.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:23824CHEBI:25698CHEBI:29347CHEBI:33853CHEBI:35681CHEBI:51689CHEBI:83403| Molecular formula | C28H42ClNO7 |
|---|---|
| Charge | 0 |
| Average mass | 540.097 Da |
| Monoisotopic mass | 539.26498 Da |
| Source | ChEBI |
| InChIKey | BIBQKWSSQXEIHK-IRFDLBBPSA-N |
CCCC[C@@H](C)[C@H](O)[C@H](C)C(=O)/C(C)=C/[C@@H](OC)[C@@H](O)[C@@H](OCC)C(=O)N/C=C\c1ccc(O)c(Cl)c1
InChI=1S/C28H42ClNO7/c1-7-9-10-17(3)24(32)19(5)25(33)18(4)15-23(36-6)26(34)27(37-8-2)28(35)30-14-13-20-11-12-22(31)21(29)16-20/h11-17,19,23-24,26-27,31-32,34H,7-10H2,1-6H3,(H,30,35)/b14-13-,18-15+/t17-,19+,23-,24+,26-,27-/m1/s1
CHEBI:33281| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:132442 |
chondrochloren B | antibioticmech:chebi-424549266c |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories