An aminoglycoside antibiotic that is part of an antimicrobial complex consisting of factors 1,2,3,5 from a soil isolate named Streptomyces hofunensis.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:22479CHEBI:22507| Molecular formula | C18H38N6O7 |
|---|---|
| Charge | 0 |
| Average mass | 450.537 Da |
| Monoisotopic mass | 450.2802 Da |
| Source | ChEBI |
| InChIKey | HJKXMQLJTKUBMG-BAOVJYBRSA-N |
CO[C@@H]1CO[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)C[C@H](O)[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](N)[C@H]1N
InChI=1S/C18H38N6O7/c1-27-10-5-28-17(13(24)12(10)23)30-15-7(20)3-8(21)16(14(15)26)31-18-11(22)9(25)2-6(4-19)29-18/h6-18,25-26H,2-5,19-24H2,1H3/t6-,7+,8-,9-,10+,11+,12-,13+,14+,15-,16+,17+,18+/m0/s1
CHEBI:33281CHEBI:36043| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:87042 |
seldomycin 5 | antibioticmech:chebi-6594c6a6be |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories