A butirosin that is butirosin B in which a γ-L-glutamyl is attached to the amino group of the (S)-4-amino-2-hydroxybutyrate side-chain.
Machine-generated and unreviewed. Identity, structure and cross-references come straight from ChEBI's and CARD's own data; no curator has signed off on this record yet.
CHEBI:65109| Molecular formula | C26H48N6O15 |
|---|---|
| Charge | 0 |
| Average mass | 684.697 Da |
| Monoisotopic mass | 684.31776 Da |
| Source | ChEBI |
| InChIKey | YGLNWHGPOZHVMV-BHZFYAMWSA-N |
NC[C@H]1O[C@H](O[C@H]2[C@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)[C@@H](O)[C@H](NC(=O)[C@@H](O)CCNC(=O)CC[C@H](N)C(=O)O)C[C@@H]2N)[C@H](N)[C@@H](O)[C@@H]1O
InChI=1S/C26H48N6O15/c27-6-12-17(37)19(39)15(30)25(44-12)46-21-9(29)5-10(16(36)22(21)47-26-20(40)18(38)13(7-33)45-26)32-23(41)11(34)3-4-31-14(35)2-1-8(28)24(42)43/h8-13,15-22,25-26,33-34,36-40H,1-7,27-30H2,(H,31,35)(H,32,41)(H,42,43)/t8-,9-,10+,11-,12+,13+,15+,16-,17+,18+,19+,20+,21+,22+,25+,26-/m0/s1
CHEBI:33281| Source | Native ID | Label | Minted CURIE | Version |
|---|---|---|---|---|
| CHEBI | CHEBI:65108 |
γ-L-glutamylbutirosin B | antibioticmech:chebi-96eb2697a9 |
2026-08-30 |
Seeded from data/raw/ inventories (CHEBI)
Re-seeded from updated data/raw/ inventories
Re-seeded from updated data/raw/ inventories